C18H15ClF3NO5 — CID 41173659
[2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 41173659) has the molecular formula C18H15ClF3NO5 and a molecular weight of 417.77 g/mol. Its IUPAC name is [2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 41173659 |
| Molecular Formula | C18H15ClF3NO5 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [2-(4-chloro-2,5-dimethoxyanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cccc(C(F)(F)F)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H15ClF3NO5/c1-26-14-8-13(15(27-2)7-12(14)19)23-16(24)9-28-17(25)10-4-3-5-11(6-10)18(20,21)22/h3-8H,9H2,1-2H3,(H,23,24) |
| InChIKey | FYWJUFRDACSDCO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |