C20H17F3N2O4 — CID 7838966
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 7838966) has the molecular formula C20H17F3N2O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7838966 |
| Molecular Formula | C20H17F3N2O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(C(F)(F)F)c1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C20H17F3N2O4/c21-20(22,23)13-5-3-4-12(10-13)19(28)29-11-17(26)25-16-7-2-1-6-15(16)18(27)24-14-8-9-14/h1-7,10,14H,8-9,11H2,(H,24,27)(H,25,26) |
| InChIKey | PXCVUAWGSDYTFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |