C20H20N4O6 — CID 7650999
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 7650999) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7650999 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCC(=O)Nc2ccccc2C(=O)NC2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O6/c1-21-16-9-6-12(10-17(16)24(28)29)20(27)30-11-18(25)23-15-5-3-2-4-14(15)19(26)22-13-7-8-13/h2-6,9-10,13,21H,7-8,11H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | PVFICVYBXYWTSW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|