C17H21N3O5 — CID 7650106
[2-(cyclopentylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 7650106) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7650106 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)NC1CCCC1 |
| InChI | InChI=1S/C17H21N3O5/c21-16(19-12-3-1-2-4-12)10-25-17(22)11-5-8-14(18-13-6-7-13)15(9-11)20(23)24/h5,8-9,12-13,18H,1-4,6-7,10H2,(H,19,21) |
| InChIKey | RTDBAOZLUQNCGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|