C15H19N3O6 — CID 7649880
[2-(2-methoxyethylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 7649880) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7649880 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | COCCNC(=O)COC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N3O6/c1-23-7-6-16-14(19)9-24-15(20)10-2-5-12(17-11-3-4-11)13(8-10)18(21)22/h2,5,8,11,17H,3-4,6-7,9H2,1H3,(H,16,19) |
| InChIKey | WWUWBLRFWFDVSW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|