C17H16N4O6 — CID 4854763
[2-(4-carbamoylanilino)-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 4854763) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4854763 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCC(=O)Nc2ccc(C(N)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N4O6/c1-19-13-7-4-11(8-14(13)21(25)26)17(24)27-9-15(22)20-12-5-2-10(3-6-12)16(18)23/h2-8,19H,9H2,1H3,(H2,18,23)(H,20,22) |
| InChIKey | OZJIYWSKFQEIQS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|