C17H13F2N3O7 — CID 7650672
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 7650672) has the molecular formula C17H13F2N3O7 and a molecular weight of 409.30 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7650672 |
| Molecular Formula | C17H13F2N3O7 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13F2N3O7/c1-20-11-4-2-9(6-12(11)22(25)26)16(24)27-8-15(23)21-10-3-5-13-14(7-10)29-17(18,19)28-13/h2-7,20H,8H2,1H3,(H,21,23) |
| InChIKey | DWWIIHULIFXYEZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|