C16H11F2NO5 — CID 7868398
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] benzoate (PubChem CID 7868398) has the molecular formula C16H11F2NO5 and a molecular weight of 335.26 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] benzoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 7868398 |
| Molecular Formula | C16H11F2NO5 |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C16H11F2NO5/c17-16(18)23-12-7-6-11(8-13(12)24-16)19-14(20)9-22-15(21)10-4-2-1-3-5-10/h1-8H,9H2,(H,19,20) |
| InChIKey | FZDSOZODEMMPIE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |