C13H11F2NO5 — CID 3886925
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] but-2-enoate (PubChem CID 3886925) has the molecular formula C13H11F2NO5 and a molecular weight of 299.23 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] but-2-enoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] but-2-enoate |
|---|---|
| PubChem CID | 3886925 |
| Molecular Formula | C13H11F2NO5 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H11F2NO5/c1-2-3-12(18)19-7-11(17)16-8-4-5-9-10(6-8)21-13(14,15)20-9/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | IWMRUGYJOYSIRZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|