C18H12F3NO5 — CID 7485390
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7485390) has the molecular formula C18H12F3NO5 and a molecular weight of 379.29 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7485390 |
| Molecular Formula | C18H12F3NO5 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1F)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C18H12F3NO5/c19-13-4-2-1-3-11(13)5-8-17(24)25-10-16(23)22-12-6-7-14-15(9-12)27-18(20,21)26-14/h1-9H,10H2,(H,22,23)/b8-5+ |
| InChIKey | PNKYPMDTFLJALJ-VMPITWQZSA-N |
| XLogP | 3.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|