C18H14FN3O4 — CID 126807763
[2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 3-(2-fluorophenyl)prop-2-enoate (PubChem CID 126807763) has the molecular formula C18H14FN3O4 and a molecular weight of 355.33 g/mol. Its IUPAC name is [2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126807763 |
| Molecular Formula | C18H14FN3O4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl] 3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccccc1F)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H14FN3O4/c19-13-4-2-1-3-11(13)5-8-17(24)26-10-16(23)20-12-6-7-14-15(9-12)22-18(25)21-14/h1-9H,10H2,(H,20,23)(H2,21,22,25) |
| InChIKey | WKZYBEDBFXRAQD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|