C21H17FN2O3S — CID 30927001
[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 30927001) has the molecular formula C21H17FN2O3S and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 30927001 |
| Molecular Formula | C21H17FN2O3S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | Cc1nc(-c2cccc(NC(=O)COC(=O)/C=C/c3ccccc3F)c2)cs1 |
| InChI | InChI=1S/C21H17FN2O3S/c1-14-23-19(13-28-14)16-6-4-7-17(11-16)24-20(25)12-27-21(26)10-9-15-5-2-3-8-18(15)22/h2-11,13H,12H2,1H3,(H,24,25)/b10-9+ |
| InChIKey | RAAQIIYOEBRDML-MDZDMXLPSA-N |
| XLogP | 4.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|