C19H18FNO3 — CID 7970069
[2-(3-ethylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7970069) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7970069 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | CCc1cccc(NC(=O)COC(=O)/C=C/c2ccccc2F)c1 |
| InChI | InChI=1S/C19H18FNO3/c1-2-14-6-5-8-16(12-14)21-18(22)13-24-19(23)11-10-15-7-3-4-9-17(15)20/h3-12H,2,13H2,1H3,(H,21,22)/b11-10+ |
| InChIKey | STOACIWYLWAEBH-ZHACJKMWSA-N |
| XLogP | 3.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|