C18H16FNO5S — CID 8973305
[2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 8973305) has the molecular formula C18H16FNO5S and a molecular weight of 377.39 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8973305 |
| Molecular Formula | C18H16FNO5S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)COC(=O)/C=C/c2ccccc2F)c1 |
| InChI | InChI=1S/C18H16FNO5S/c1-26(23,24)15-7-4-6-14(11-15)20-17(21)12-25-18(22)10-9-13-5-2-3-8-16(13)19/h2-11H,12H2,1H3,(H,20,21)/b10-9+ |
| InChIKey | NOKUMTLIIIGNAW-MDZDMXLPSA-N |
| XLogP | 2.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|