C19H18FNO6S — CID 9001117
[2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate (PubChem CID 9001117) has the molecular formula C19H18FNO6S and a molecular weight of 407.42 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9001117 |
| Molecular Formula | C19H18FNO6S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] (E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)Nc2cccc(S(C)(=O)=O)c2)cc1F |
| InChI | InChI=1S/C19H18FNO6S/c1-26-17-8-6-13(10-16(17)20)7-9-19(23)27-12-18(22)21-14-4-3-5-15(11-14)28(2,24)25/h3-11H,12H2,1-2H3,(H,21,22)/b9-7+ |
| InChIKey | PAPRJTPTZDUGFO-VQHVLOKHSA-N |
| XLogP | 2.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|