C19H20N2O6S — CID 31828818
[2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 31828818) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 31828818 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OCC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C19H20N2O6S/c1-2-26-16-9-6-14(7-10-16)8-11-19(23)27-13-18(22)21-15-4-3-5-17(12-15)28(20,24)25/h3-12H,2,13H2,1H3,(H,21,22)(H2,20,24,25)/b11-8+ |
| InChIKey | XDHHVPKAJJMLPT-DHZHZOJOSA-N |
| XLogP | 1.93 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|