C20H17N3O5S — CID 16607850
[2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16607850) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16607850 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)/C=C/c2cccc3cccnc23)c1 |
| InChI | InChI=1S/C20H17N3O5S/c21-29(26,27)17-8-2-7-16(12-17)23-18(24)13-28-19(25)10-9-15-5-1-4-14-6-3-11-22-20(14)15/h1-12H,13H2,(H,23,24)(H2,21,26,27)/b10-9+ |
| InChIKey | PDRUGWVJUOYIFZ-MDZDMXLPSA-N |
| XLogP | 2.08 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|