C24H21N3O4 — CID 16608276
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608276) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608276 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc2cccnc12)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C24H21N3O4/c28-21(26-19-8-2-9-20(15-19)27-14-4-10-22(27)29)16-31-23(30)12-11-18-6-1-5-17-7-3-13-25-24(17)18/h1-3,5-9,11-13,15H,4,10,14,16H2,(H,26,28)/b12-11+ |
| InChIKey | NQJSSWRAWVAJEJ-VAWYXSNFSA-N |
| XLogP | 3.56 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|