C24H21N3O5 — CID 36609935
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-phenoxypyridine-3-carboxylate (PubChem CID 36609935) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-phenoxypyridine-3-carboxylate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-phenoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 36609935 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-phenoxypyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Oc1ccccc1)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C24H21N3O5/c28-21(26-17-7-4-8-18(15-17)27-14-6-12-22(27)29)16-31-24(30)20-11-5-13-25-23(20)32-19-9-2-1-3-10-19/h1-5,7-11,13,15H,6,12,14,16H2,(H,26,28) |
| InChIKey | DNMIHDHHSOONHX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |