C22H18N2O4 — CID 51110358
[4-(2-oxopyrrolidin-1-yl)phenyl] 2-phenoxypyridine-3-carboxylate (PubChem CID 51110358) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 2-phenoxypyridine-3-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-phenoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 51110358 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-phenoxypyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(N2CCCC2=O)cc1)c1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c25-20-9-5-15-24(20)16-10-12-18(13-11-16)28-22(26)19-8-4-14-23-21(19)27-17-6-2-1-3-7-17/h1-4,6-8,10-14H,5,9,15H2 |
| InChIKey | ITEIBOVGIRNSAQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|