C21H19N3O3S — CID 46611893
[4-(2-oxopyrrolidin-1-yl)phenyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate (PubChem CID 46611893) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 46611893 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
| SMILES | CSc1ncc(C(=O)Oc2ccc(N3CCCC3=O)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-28-21-22-14-18(24(21)16-6-3-2-4-7-16)20(26)27-17-11-9-15(10-12-17)23-13-5-8-19(23)25/h2-4,6-7,9-12,14H,5,8,13H2,1H3 |
| InChIKey | SOROJUNXTMNUNG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|