C19H19NO5 — CID 174500100
5-methylbenzene-1,3-dicarboxylic acid;1-phenylpyrrolidin-2-one (PubChem CID 174500100) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 5-methylbenzene-1,3-dicarboxylic acid;1-phenylpyrrolidin-2-one.
| Compound Name | 5-methylbenzene-1,3-dicarboxylic acid;1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 174500100 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 5-methylbenzene-1,3-dicarboxylic acid;1-phenylpyrrolidin-2-one |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)O)c1.O=C1CCCN1c1ccccc1 |
| InChI | InChI=1S/C10H11NO.C9H8O4/c12-10-7-4-8-11(10)9-5-2-1-3-6-9;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h1-3,5-6H,4,7-8H2;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | SCLQFASQNBQIQQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |