C12H15NO — CID 847897
1-(3,5-dimethylphenyl)pyrrolidin-2-one (PubChem CID 847897) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)pyrrolidin-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 847897 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(3,5-dimethylphenyl)pyrrolidin-2-one |
| SMILES | Cc1cc(C)cc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C12H15NO/c1-9-6-10(2)8-11(7-9)13-5-3-4-12(13)14/h6-8H,3-5H2,1-2H3 |
| InChIKey | OQCOZQAALBYNRH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |