C18H27NO2 — CID 6918219
1-(3,5-ditert-butyl-4-hydroxyphenyl)pyrrolidin-2-one (PubChem CID 6918219) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)pyrrolidin-2-one.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 6918219 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)c1cc(N2CCCC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H27NO2/c1-17(2,3)13-10-12(19-9-7-8-15(19)20)11-14(16(13)21)18(4,5)6/h10-11,21H,7-9H2,1-6H3 |
| InChIKey | OWJSEESROFTAQV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |