C41H43N3O — CID 172516998
1-[3,5-bis[4-(4-tert-butyl-3-pyridinyl)phenyl]phenyl]piperidin-2-one (PubChem CID 172516998) has the molecular formula C41H43N3O and a molecular weight of 593.82 g/mol. Its IUPAC name is 1-[3,5-bis[4-(4-tert-butyl-3-pyridinyl)phenyl]phenyl]piperidin-2-one.
| Compound Name | 1-[3,5-bis[4-(4-tert-butyl-3-pyridinyl)phenyl]phenyl]piperidin-2-one |
|---|---|
| PubChem CID | 172516998 |
| Molecular Formula | C41H43N3O |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 1-[3,5-bis[4-(4-tert-butyl-3-pyridinyl)phenyl]phenyl]piperidin-2-one |
| SMILES | CC(C)(C)c1ccncc1-c1ccc(-c2cc(-c3ccc(-c4cnccc4C(C)(C)C)cc3)cc(N3CCCCC3=O)c2)cc1 |
| InChI | InChI=1S/C41H43N3O/c1-40(2,3)37-18-20-42-26-35(37)30-14-10-28(11-15-30)32-23-33(25-34(24-32)44-22-8-7-9-39(44)45)29-12-16-31(17-13-29)36-27-43-21-19-38(36)41(4,5)6/h10-21,23-27H,7-9,22H2,1-6H3 |
| InChIKey | IDYQLJBDLXQOPX-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |