C45H69N3O3 — CID 141047471
4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-1,3,5-triazinan-1-yl]-2,6-ditert-butylphenol (PubChem CID 141047471) has the molecular formula C45H69N3O3 and a molecular weight of 700.06 g/mol. Its IUPAC name is 4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-1,3,5-triazinan-1-yl]-2,6-ditert-butylphenol.
| Compound Name | 4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-1,3,5-triazinan-1-yl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 141047471 |
| Molecular Formula | C45H69N3O3 |
| Molecular Weight | 700.06 g/mol |
| Exact Mass | 699.53 |
| IUPAC Name | 4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-1,3,5-triazinan-1-yl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(N2CN(c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CN(c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C45H69N3O3/c1-40(2,3)31-19-28(20-32(37(31)49)41(4,5)6)46-25-47(29-21-33(42(7,8)9)38(50)34(22-29)43(10,11)12)27-48(26-46)30-23-35(44(13,14)15)39(51)36(24-30)45(16,17)18/h19-24,49-51H,25-27H2,1-18H3 |
| InChIKey | BHZBZWWMAWBAKX-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.06 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |