C15H22IO2- — CID 153384878
CID 153384878 (PubChem CID 153384878) has the molecular formula C15H22IO2- and a molecular weight of 361.24 g/mol.
| Compound Name | CID 153384878 |
|---|---|
| PubChem CID | 153384878 |
| Molecular Formula | C15H22IO2- |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(C(=O)[IH-])cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C15H21IO2/c1-14(2,3)10-7-9(13(16)18)8-11(12(10)17)15(4,5)6/h7-8,17H,1-6H3/q-1 |
| InChIKey | HDKAPQGBZDAXGV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|