C29H42O3S — CID 57066094
S-(3,5-ditert-butyl-4-hydroxyphenyl) 3,5-ditert-butyl-4-hydroxybenzenecarbothioate (PubChem CID 57066094) has the molecular formula C29H42O3S and a molecular weight of 470.72 g/mol. Its IUPAC name is S-(3,5-ditert-butyl-4-hydroxyphenyl) 3,5-ditert-butyl-4-hydroxybenzenecarbothioate.
| Compound Name | S-(3,5-ditert-butyl-4-hydroxyphenyl) 3,5-ditert-butyl-4-hydroxybenzenecarbothioate |
|---|---|
| PubChem CID | 57066094 |
| Molecular Formula | C29H42O3S |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | S-(3,5-ditert-butyl-4-hydroxyphenyl) 3,5-ditert-butyl-4-hydroxybenzenecarbothioate |
| SMILES | CC(C)(C)c1cc(SC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H42O3S/c1-26(2,3)19-13-17(14-20(23(19)30)27(4,5)6)25(32)33-18-15-21(28(7,8)9)24(31)22(16-18)29(10,11)12/h13-16,30-31H,1-12H3 |
| InChIKey | GDUCZRXKKPGHRE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|