C42H63O3PS3 — CID 88686574
4-bis[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl]phosphanylsulfanyl-2,6-ditert-butylphenol (PubChem CID 88686574) has the molecular formula C42H63O3PS3 and a molecular weight of 743.14 g/mol. Its IUPAC name is 4-bis[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl]phosphanylsulfanyl-2,6-ditert-butylphenol.
| Compound Name | 4-bis[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl]phosphanylsulfanyl-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 88686574 |
| Molecular Formula | C42H63O3PS3 |
| Molecular Weight | 743.14 g/mol |
| Exact Mass | 742.37 |
| IUPAC Name | 4-bis[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl]phosphanylsulfanyl-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(SP(Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C42H63O3PS3/c1-37(2,3)28-19-25(20-29(34(28)43)38(4,5)6)47-46(48-26-21-30(39(7,8)9)35(44)31(22-26)40(10,11)12)49-27-23-32(41(13,14)15)36(45)33(24-27)42(16,17)18/h19-24,43-45H,1-18H3 |
| InChIKey | HOBCJGOLFPTFSG-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.14 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|