C28H42O2S6 — CID 15852116
2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)hexasulfanyl]phenol (PubChem CID 15852116) has the molecular formula C28H42O2S6 and a molecular weight of 603.04 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)hexasulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)hexasulfanyl]phenol |
|---|---|
| PubChem CID | 15852116 |
| Molecular Formula | C28H42O2S6 |
| Molecular Weight | 603.04 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)hexasulfanyl]phenol |
| SMILES | CC(C)(C)c1cc(SSSSSSc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H42O2S6/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)31-33-35-36-34-32-18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16,29-30H,1-12H3 |
| InChIKey | UKLUVMURMNGFRX-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.04 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|