C15H21LiO3 — CID 139788661
lithium 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 139788661) has the molecular formula C15H21LiO3 and a molecular weight of 256.27 g/mol. Its IUPAC name is lithium 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | lithium 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 139788661 |
| Molecular Formula | C15H21LiO3 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | lithium 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)[O-])cc(C(C)(C)C)c1O.[Li+] |
| InChI | InChI=1S/C15H22O3.Li/c1-14(2,3)10-7-9(13(17)18)8-11(12(10)16)15(4,5)6;/h7-8,16H,1-6H3,(H,17,18);/q;+1/p-1 |
| InChIKey | OGEFELQONGSXKY-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |