C15H21O2- — CID 6951692
3,5-ditert-butylbenzoate (PubChem CID 6951692) has the molecular formula C15H21O2- and a molecular weight of 233.33 g/mol. Its IUPAC name is 3,5-ditert-butylbenzoate.
| Compound Name | 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 6951692 |
| Molecular Formula | C15H21O2- |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3,5-ditert-butylbenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)[O-])cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(13(16)17)8-12(9-11)15(4,5)6/h7-9H,1-6H3,(H,16,17)/p-1 |
| InChIKey | NCTSLPBQVXUAHR-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |