C9H3F6NaO2 — CID 23682278
sodium 3,5-bis(trifluoromethyl)benzoate (PubChem CID 23682278) has the molecular formula C9H3F6NaO2 and a molecular weight of 280.10 g/mol. Its IUPAC name is sodium 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | sodium 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 23682278 |
| Molecular Formula | C9H3F6NaO2 |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | sodium 3,5-bis(trifluoromethyl)benzoate |
| SMILES | O=C([O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Na+] |
| InChI | InChI=1S/C9H4F6O2.Na/c10-8(11,12)5-1-4(7(16)17)2-6(3-5)9(13,14)15;/h1-3H,(H,16,17);/q;+1/p-1 |
| InChIKey | MBFVIUZTQNHGAQ-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |