C17H6F12Zr+2 — CID 87101400
bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+) (PubChem CID 87101400) has the molecular formula C17H6F12Zr+2 and a molecular weight of 529.44 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+).
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+) |
|---|---|
| PubChem CID | 87101400 |
| Molecular Formula | C17H6F12Zr+2 |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 527.93 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+) |
| SMILES | FC(F)(F)c1cc(C(=[Zr+2])c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H6F12.Zr/c18-14(19,20)10-2-8(3-11(6-10)15(21,22)23)1-9-4-12(16(24,25)26)7-13(5-9)17(27,28)29;/h2-7H;/q;+2 |
| InChIKey | JNJMFLBJXFCDRT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |