C51H52F12Zr — CID 87668590
bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+);cyclopenta-1,3-diene;2,3,6,7-tetratert-butyl-9H-fluoren-9-ide (PubChem CID 87668590) has the molecular formula C51H52F12Zr and a molecular weight of 984.18 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+);cyclopenta-1,3-diene;2,3,6,7-tetratert-butyl-9H-fluoren-9-ide.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+);cyclopenta-1,3-diene;2,3,6,7-tetratert-butyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 87668590 |
| Molecular Formula | C51H52F12Zr |
| Molecular Weight | 984.18 g/mol |
| Exact Mass | 982.29 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]methylidenezirconium(2+);cyclopenta-1,3-diene;2,3,6,7-tetratert-butyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1cc2[cH-]c3cc(C(C)(C)C)c(C(C)(C)C)cc3c2cc1C(C)(C)C.FC(F)(F)c1cc(C(=[Zr+2])c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.[C-]1=CC=CC1 |
| InChI | InChI=1S/C29H41.C17H6F12.C5H5.Zr/c1-26(2,3)22-14-18-13-19-15-23(27(4,5)6)25(29(10,11)12)17-21(19)20(18)16-24(22)28(7,8)9;18-14(19,20)10-2-8(3-11(6-10)15(21,22)23)1-9-4-12(16(24,25)26)7-13(5-9)17(27,28)29;1-2-4-5-3-1;/h13-17H,1-12H3;2-7H;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | WLAATMASPOSULM-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.18 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|