C39H40Zr — CID 173229252
benzhydrylidenezirconium(2+);cyclopenta-1,3-diene;1,6-ditert-butyl-9H-fluoren-9-ide (PubChem CID 173229252) has the molecular formula C39H40Zr and a molecular weight of 599.97 g/mol. Its IUPAC name is benzhydrylidenezirconium(2+);cyclopenta-1,3-diene;1,6-ditert-butyl-9H-fluoren-9-ide.
| Compound Name | benzhydrylidenezirconium(2+);cyclopenta-1,3-diene;1,6-ditert-butyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173229252 |
| Molecular Formula | C39H40Zr |
| Molecular Weight | 599.97 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | benzhydrylidenezirconium(2+);cyclopenta-1,3-diene;1,6-ditert-butyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1ccc2[cH-]c3c(C(C)(C)C)cccc3c2c1.[C-]1=CC=CC1.[Zr+2]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25.C13H10.C5H5.Zr/c1-20(2,3)15-11-10-14-12-18-16(17(14)13-15)8-7-9-19(18)21(4,5)6;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-4-5-3-1;/h7-13H,1-6H3;1-10H;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | CBVAGZKGHHSGBF-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.97 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|