C40H41ClZr — CID 87678893
[(3-chlorophenyl)-(4-methylphenyl)methylidene]zirconium(2+);cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide (PubChem CID 87678893) has the molecular formula C40H41ClZr and a molecular weight of 648.45 g/mol. Its IUPAC name is [(3-chlorophenyl)-(4-methylphenyl)methylidene]zirconium(2+);cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide.
| Compound Name | [(3-chlorophenyl)-(4-methylphenyl)methylidene]zirconium(2+);cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 87678893 |
| Molecular Formula | C40H41ClZr |
| Molecular Weight | 648.45 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | [(3-chlorophenyl)-(4-methylphenyl)methylidene]zirconium(2+);cyclopenta-1,3-diene;3,6-ditert-butyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1ccc2[cH-]c3ccc(C(C)(C)C)cc3c2c1.Cc1ccc(C(=[Zr+2])c2cccc(Cl)c2)cc1.[C-]1=CC=CC1 |
| InChI | InChI=1S/C21H25.C14H11Cl.C5H5.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-11-5-7-12(8-6-11)9-13-3-2-4-14(15)10-13;1-2-4-5-3-1;/h7-13H,1-6H3;2-8,10H,1H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | FEPZZSUKKZXPHD-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.45 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|