C21H25Hf- — CID 173107283
1,6-ditert-butyl-9H-fluoren-9-ide;hafnium (PubChem CID 173107283) has the molecular formula C21H25Hf- and a molecular weight of 455.92 g/mol. Its IUPAC name is 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium.
| Compound Name | 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium |
|---|---|
| PubChem CID | 173107283 |
| Molecular Formula | C21H25Hf- |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium |
| SMILES | CC(C)(C)c1ccc2[cH-]c3c(C(C)(C)C)cccc3c2c1.[Hf] |
| InChI | InChI=1S/C21H25.Hf/c1-20(2,3)15-11-10-14-12-18-16(17(14)13-15)8-7-9-19(18)21(4,5)6;/h7-13H,1-6H3;/q-1; |
| InChIKey | CGHXKFPMMYTZBR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|