About 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium
1,6-ditert-butyl-9H-fluoren-9-ide;hafnium (PubChem CID 173107283) has the molecular formula C21H25Hf-
and a molecular weight of 455.92 g/mol. Its IUPAC name is 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium.
Molecular Properties
| Compound Name | 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium |
| PubChem CID | 173107283 |
| Molecular Formula | C21H25Hf- |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium |
| SMILES | CC(C)(C)c1ccc2[cH-]c3c(C(C)(C)C)cccc3c2c1.[Hf] |
| InChI | InChI=1S/C21H25.Hf/c1-20(2,3)15-11-10-14-12-18-16(17(14)13-15)8-7-9-19(18)21(4,5)6;/h7-13H,1-6H3;/q-1; |
| InChIKey | CGHXKFPMMYTZBR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium?
The IUPAC name of 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium (CID 173107283) is 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium.
What is the SMILES notation for 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium?
The canonical SMILES for 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium is CC(C)(C)c1ccc2[cH-]c3c(C(C)(C)C)cccc3c2c1.[Hf].
What is the InChIKey of 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium?
The InChIKey is CGHXKFPMMYTZBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25.Hf/c1-20(2,3)15-11-10-14-12-18-16(17(14)13-15)8-7-9-19(18)21(4,5)6;/h7-13H,1-6H3;/q-1;.
What are the key properties of 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium?
1,6-ditert-butyl-9H-fluoren-9-ide;hafnium has a molecular weight of 455.92 g/mol, XLogP of 6.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-ditert-butyl-9H-fluoren-9-ide;hafnium is sourced from PubChem (CID 173107283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).