C18H24 — CID 59350345
1,7-ditert-butylnaphthalene (PubChem CID 59350345) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,7-ditert-butylnaphthalene.
| Compound Name | 1,7-ditert-butylnaphthalene |
|---|---|
| PubChem CID | 59350345 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1,7-ditert-butylnaphthalene |
| SMILES | CC(C)(C)c1ccc2cccc(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C18H24/c1-17(2,3)14-11-10-13-8-7-9-16(15(13)12-14)18(4,5)6/h7-12H,1-6H3 |
| InChIKey | YFVSDBQBNLLZOL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |