C31H29Zr- — CID 173148368
3,6-bis(2-phenylpropan-2-yl)-9H-fluoren-9-ide;zirconium (PubChem CID 173148368) has the molecular formula C31H29Zr- and a molecular weight of 492.80 g/mol. Its IUPAC name is 3,6-bis(2-phenylpropan-2-yl)-9H-fluoren-9-ide;zirconium.
| Compound Name | 3,6-bis(2-phenylpropan-2-yl)-9H-fluoren-9-ide;zirconium |
|---|---|
| PubChem CID | 173148368 |
| Molecular Formula | C31H29Zr- |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3,6-bis(2-phenylpropan-2-yl)-9H-fluoren-9-ide;zirconium |
| SMILES | CC(C)(c1ccccc1)c1ccc2[cH-]c3ccc(C(C)(C)c4ccccc4)cc3c2c1.[Zr] |
| InChI | InChI=1S/C31H29.Zr/c1-30(2,24-11-7-5-8-12-24)26-17-15-22-19-23-16-18-27(21-29(23)28(22)20-26)31(3,4)25-13-9-6-10-14-25;/h5-21H,1-4H3;/q-1; |
| InChIKey | HVLXRURRVBKCBZ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|