C24H27N — CID 142144538
3,5-bis(2-phenylpropan-2-yl)aniline (PubChem CID 142144538) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is 3,5-bis(2-phenylpropan-2-yl)aniline.
| Compound Name | 3,5-bis(2-phenylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 142144538 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 3,5-bis(2-phenylpropan-2-yl)aniline |
| SMILES | CC(C)(c1ccccc1)c1cc(N)cc(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27N/c1-23(2,18-11-7-5-8-12-18)20-15-21(17-22(25)16-20)24(3,4)19-13-9-6-10-14-19/h5-17H,25H2,1-4H3 |
| InChIKey | WTKRGQXEKCFZCO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|