C27H31N — CID 171500783
1-[3,5-bis(2-phenylpropan-2-yl)phenyl]-N-ethylmethanimine (PubChem CID 171500783) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is 1-[3,5-bis(2-phenylpropan-2-yl)phenyl]-N-ethylmethanimine.
| Compound Name | 1-[3,5-bis(2-phenylpropan-2-yl)phenyl]-N-ethylmethanimine |
|---|---|
| PubChem CID | 171500783 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-[3,5-bis(2-phenylpropan-2-yl)phenyl]-N-ethylmethanimine |
| SMILES | CC/N=C/c1cc(C(C)(C)c2ccccc2)cc(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C27H31N/c1-6-28-20-21-17-24(26(2,3)22-13-9-7-10-14-22)19-25(18-21)27(4,5)23-15-11-8-12-16-23/h7-20H,6H2,1-5H3/b28-20+ |
| InChIKey | XSPVKHWBXWIBND-VFCFBJKWSA-N |
| XLogP | 6.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|