C57H60N2O2 — CID 171500786
2-[[2-[[3,5-bis(2-phenylpropan-2-yl)phenyl]methylideneamino]phenyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol;methanol (PubChem CID 171500786) has the molecular formula C57H60N2O2 and a molecular weight of 805.12 g/mol. Its IUPAC name is 2-[[2-[[3,5-bis(2-phenylpropan-2-yl)phenyl]methylideneamino]phenyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol;methanol.
| Compound Name | 2-[[2-[[3,5-bis(2-phenylpropan-2-yl)phenyl]methylideneamino]phenyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol;methanol |
|---|---|
| PubChem CID | 171500786 |
| Molecular Formula | C57H60N2O2 |
| Molecular Weight | 805.12 g/mol |
| Exact Mass | 804.47 |
| IUPAC Name | 2-[[2-[[3,5-bis(2-phenylpropan-2-yl)phenyl]methylideneamino]phenyl]iminomethyl]-4,6-bis(2-phenylpropan-2-yl)phenol;methanol |
| SMILES | CC(C)(c1ccccc1)c1cc(/C=N/c2ccccc2/N=C\c2cc(C(C)(C)c3ccccc3)cc(C(C)(C)c3ccccc3)c2O)cc(C(C)(C)c2ccccc2)c1.CO |
| InChI | InChI=1S/C56H56N2O.CH4O/c1-53(2,42-23-13-9-14-24-42)46-33-40(34-47(36-46)54(3,4)43-25-15-10-16-26-43)38-57-50-31-21-22-32-51(50)58-39-41-35-48(55(5,6)44-27-17-11-18-28-44)37-49(52(41)59)56(7,8)45-29-19-12-20-30-45;1-2/h9-39,59H,1-8H3;2H,1H3/b57-38+,58-39-; |
| InChIKey | FQQUCSKXGVEVDD-CHIJJNMASA-N |
| XLogP | 13.81 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.12 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|