C31H43NO — CID 143795526
2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol;ethane;toluene (PubChem CID 143795526) has the molecular formula C31H43NO and a molecular weight of 445.69 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol;ethane;toluene.
| Compound Name | 2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol;ethane;toluene |
|---|---|
| PubChem CID | 143795526 |
| Molecular Formula | C31H43NO |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol;ethane;toluene |
| SMILES | CC.Cc1ccccc1.Cc1ccccc1/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H29NO.C7H8.C2H6/c1-15-10-8-9-11-19(15)23-14-16-12-17(21(2,3)4)13-18(20(16)24)22(5,6)7;1-7-5-3-2-4-6-7;1-2/h8-14,24H,1-7H3;2-6H,1H3;1-2H3/b23-14+;; |
| InChIKey | LBZYVSKTUJPWPC-PQZUSRQGSA-N |
| XLogP | 9.07 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|