C29H32N2O3 — CID 175778675
3-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]-4-hydroxybenzaldehyde (PubChem CID 175778675) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]-4-hydroxybenzaldehyde.
| Compound Name | 3-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]-4-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 175778675 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 3-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]-4-hydroxybenzaldehyde |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2/N=C\c2cc(C=O)ccc2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H32N2O3/c1-28(2,3)22-14-21(27(34)23(15-22)29(4,5)6)17-31-25-10-8-7-9-24(25)30-16-20-13-19(18-32)11-12-26(20)33/h7-18,33-34H,1-6H3/b30-16-,31-17+ |
| InChIKey | YJMCPRZJOYUUBI-RQCICOGXSA-N |
| XLogP | 7.01 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|