C28H31N3O4 — CID 139203413
2,4-ditert-butyl-6-[[2-[(2-hydroxyphenyl)methylideneamino]-4-nitrophenyl]iminomethyl]phenol (PubChem CID 139203413) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-[(2-hydroxyphenyl)methylideneamino]-4-nitrophenyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-[(2-hydroxyphenyl)methylideneamino]-4-nitrophenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139203413 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-[(2-hydroxyphenyl)methylideneamino]-4-nitrophenyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccc([N+](=O)[O-])cc2/N=C/c2ccccc2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H31N3O4/c1-27(2,3)20-13-19(26(33)22(14-20)28(4,5)6)17-29-23-12-11-21(31(34)35)15-24(23)30-16-18-9-7-8-10-25(18)32/h7-17,32-33H,1-6H3/b29-17+,30-16+ |
| InChIKey | GAPYDYZGIISCFW-FAPVJKTESA-N |
| XLogP | 7.10 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|