C21H27NOSTi — CID 160643890
2,4-ditert-butyl-6-[(2-sulfanylphenyl)iminomethyl]phenol;titanium (PubChem CID 160643890) has the molecular formula C21H27NOSTi and a molecular weight of 389.39 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-sulfanylphenyl)iminomethyl]phenol;titanium.
| Compound Name | 2,4-ditert-butyl-6-[(2-sulfanylphenyl)iminomethyl]phenol;titanium |
|---|---|
| PubChem CID | 160643890 |
| Molecular Formula | C21H27NOSTi |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-sulfanylphenyl)iminomethyl]phenol;titanium |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2S)c(O)c(C(C)(C)C)c1.[Ti] |
| InChI | InChI=1S/C21H27NOS.Ti/c1-20(2,3)15-11-14(19(23)16(12-15)21(4,5)6)13-22-17-9-7-8-10-18(17)24;/h7-13,23-24H,1-6H3;/b22-13+; |
| InChIKey | RJNLXISPRLINEB-PNAHYYPNSA-N |
| XLogP | 6.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|