C42H52N2O3 — CID 137211461
2,4-ditert-butyl-6-[[2-[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenol (PubChem CID 137211461) has the molecular formula C42H52N2O3 and a molecular weight of 632.89 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137211461 |
| Molecular Formula | C42H52N2O3 |
| Molecular Weight | 632.89 g/mol |
| Exact Mass | 632.40 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenoxy]phenyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N\c2ccccc2Oc2ccccc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H52N2O3/c1-39(2,3)29-21-27(37(45)31(23-29)41(7,8)9)25-43-33-17-13-15-19-35(33)47-36-20-16-14-18-34(36)44-26-28-22-30(40(4,5)6)24-32(38(28)46)42(10,11)12/h13-26,45-46H,1-12H3/b43-25-,44-26+ |
| InChIKey | IGCCWTQMCCXNHO-OBWYSMLFSA-N |
| XLogP | 11.58 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.89 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|