C26H35NO — CID 137225849
2,4-ditert-butyl-6-[(2-cyclopentylphenyl)iminomethyl]phenol (PubChem CID 137225849) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-cyclopentylphenyl)iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2-cyclopentylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137225849 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-cyclopentylphenyl)iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2C2CCCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H35NO/c1-25(2,3)20-15-19(24(28)22(16-20)26(4,5)6)17-27-23-14-10-9-13-21(23)18-11-7-8-12-18/h9-10,13-18,28H,7-8,11-12H2,1-6H3/b27-17+ |
| InChIKey | PXHVFZFWXSIDQL-WPWMEQJKSA-N |
| XLogP | 7.40 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|