C29H39NO — CID 137225880
2-tert-butyl-6-[(2,6-dicyclohexylphenyl)iminomethyl]phenol (PubChem CID 137225880) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is 2-tert-butyl-6-[(2,6-dicyclohexylphenyl)iminomethyl]phenol.
| Compound Name | 2-tert-butyl-6-[(2,6-dicyclohexylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137225880 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 2-tert-butyl-6-[(2,6-dicyclohexylphenyl)iminomethyl]phenol |
| SMILES | CC(C)(C)c1cccc(/C=N/c2c(C3CCCCC3)cccc2C2CCCCC2)c1O |
| InChI | InChI=1S/C29H39NO/c1-29(2,3)26-19-10-16-23(28(26)31)20-30-27-24(21-12-6-4-7-13-21)17-11-18-25(27)22-14-8-5-9-15-22/h10-11,16-22,31H,4-9,12-15H2,1-3H3/b30-20+ |
| InChIKey | QJTZVUGMPYORBI-TWKHWXDSSA-N |
| XLogP | 8.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|